C8F8I2 — CID 10649104
3,3,4,4-tetrafluoro-1-iodo-2-(3,3,4,4-tetrafluoro-2-iodocyclobuten-1-yl)cyclobutene (PubChem CID 10649104) has the molecular formula C8F8I2 and a molecular weight of 501.88 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1-iodo-2-(3,3,4,4-tetrafluoro-2-iodocyclobuten-1-yl)cyclobutene.
| Compound Name | 3,3,4,4-tetrafluoro-1-iodo-2-(3,3,4,4-tetrafluoro-2-iodocyclobuten-1-yl)cyclobutene |
|---|---|
| PubChem CID | 10649104 |
| Molecular Formula | C8F8I2 |
| Molecular Weight | 501.88 g/mol |
| Exact Mass | 501.80 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1-iodo-2-(3,3,4,4-tetrafluoro-2-iodocyclobuten-1-yl)cyclobutene |
| SMILES | FC1(F)C(I)=C(C2=C(I)C(F)(F)C2(F)F)C1(F)F |
| InChI | InChI=1S/C8F8I2/c9-5(10)1(3(17)7(5,13)14)2-4(18)8(15,16)6(2,11)12 |
| InChIKey | HTIIOHDDXAFNDG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.88 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|