C10F12I2 — CID 10579496
3,3,4,4,5,5-hexafluoro-1-(3,3,4,4,5,5-hexafluoro-2-iodocyclopenten-1-yl)-2-iodocyclopentene (PubChem CID 10579496) has the molecular formula C10F12I2 and a molecular weight of 601.89 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(3,3,4,4,5,5-hexafluoro-2-iodocyclopenten-1-yl)-2-iodocyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(3,3,4,4,5,5-hexafluoro-2-iodocyclopenten-1-yl)-2-iodocyclopentene |
|---|---|
| PubChem CID | 10579496 |
| Molecular Formula | C10F12I2 |
| Molecular Weight | 601.89 g/mol |
| Exact Mass | 601.79 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(3,3,4,4,5,5-hexafluoro-2-iodocyclopenten-1-yl)-2-iodocyclopentene |
| SMILES | FC1(F)C(I)=C(C2=C(I)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10F12I2/c11-5(12)1(3(23)7(15,16)9(5,19)20)2-4(24)8(17,18)10(21,22)6(2,13)14 |
| InChIKey | YKYRVYUDTGZIMR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.89 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|