C10F14 — CID 11395047
1,3,3,4,4,5,5-heptafluoro-2-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)cyclopentene (PubChem CID 11395047) has the molecular formula C10F14 and a molecular weight of 386.08 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)cyclopentene |
|---|---|
| PubChem CID | 11395047 |
| Molecular Formula | C10F14 |
| Molecular Weight | 386.08 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)cyclopentene |
| SMILES | FC1=C(C2=C(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10F14/c11-3-1(5(13,14)9(21,22)7(3,17)18)2-4(12)8(19,20)10(23,24)6(2,15)16 |
| InChIKey | ICOFQNWSLAWKEQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.08 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|