C8F14 — CID 12808573
3,3,4,4,5,5-hexafluoro-1-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)cyclopentene (PubChem CID 12808573) has the molecular formula C8F14 and a molecular weight of 362.06 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)cyclopentene |
|---|---|
| PubChem CID | 12808573 |
| Molecular Formula | C8F14 |
| Molecular Weight | 362.06 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)cyclopentene |
| SMILES | FC(F)(F)C1=C(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8F14/c9-3(10)1(5(13,14)8(20,21)22)2(6(15,16)17)4(11,12)7(3,18)19 |
| InChIKey | DUKLVWYBSAUHAB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.06 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|