C11F16 — CID 15628706
1,1,4,4,5,5,6,6,7,7-decafluoro-2,3-bis(trifluoromethyl)indene (PubChem CID 15628706) has the molecular formula C11F16 and a molecular weight of 436.09 g/mol. Its IUPAC name is 1,1,4,4,5,5,6,6,7,7-decafluoro-2,3-bis(trifluoromethyl)indene.
| Compound Name | 1,1,4,4,5,5,6,6,7,7-decafluoro-2,3-bis(trifluoromethyl)indene |
|---|---|
| PubChem CID | 15628706 |
| Molecular Formula | C11F16 |
| Molecular Weight | 436.09 g/mol |
| Exact Mass | 435.97 |
| IUPAC Name | 1,1,4,4,5,5,6,6,7,7-decafluoro-2,3-bis(trifluoromethyl)indene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C(F)(F)C2=C1C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C11F16/c12-5(13)3-1(2(8(18,19)20)4(5)9(21,22)23)6(14,15)10(24,25)11(26,27)7(3,16)17 |
| InChIKey | FRXRBBCBNSCVNV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.09 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|