C8F10 — CID 14664213
1,3,3,4,4-pentafluoro-2-(2,3,3,4,4-pentafluorocyclobuten-1-yl)cyclobutene (PubChem CID 14664213) has the molecular formula C8F10 and a molecular weight of 286.07 g/mol. Its IUPAC name is 1,3,3,4,4-pentafluoro-2-(2,3,3,4,4-pentafluorocyclobuten-1-yl)cyclobutene.
| Compound Name | 1,3,3,4,4-pentafluoro-2-(2,3,3,4,4-pentafluorocyclobuten-1-yl)cyclobutene |
|---|---|
| PubChem CID | 14664213 |
| Molecular Formula | C8F10 |
| Molecular Weight | 286.07 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 1,3,3,4,4-pentafluoro-2-(2,3,3,4,4-pentafluorocyclobuten-1-yl)cyclobutene |
| SMILES | FC1=C(C2=C(F)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8F10/c9-3-1(5(11,12)7(3,15)16)2-4(10)8(17,18)6(2,13)14 |
| InChIKey | LAYACEPWZQXQCG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.07 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|