C11H12BrFN4O2S — CID 106492105
2-amino-5-bromo-4-fluoro-N-[1-(1H-imidazol-2-yl)ethyl]benzenesulfonamide (PubChem CID 106492105) has the molecular formula C11H12BrFN4O2S and a molecular weight of 363.21 g/mol. Its IUPAC name is 2-amino-5-bromo-4-fluoro-N-[1-(1H-imidazol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-5-bromo-4-fluoro-N-[1-(1H-imidazol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106492105 |
| Molecular Formula | C11H12BrFN4O2S |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 2-amino-5-bromo-4-fluoro-N-[1-(1H-imidazol-2-yl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(Br)c(F)cc1N)c1ncc[nH]1 |
| InChI | InChI=1S/C11H12BrFN4O2S/c1-6(11-15-2-3-16-11)17-20(18,19)10-4-7(12)8(13)5-9(10)14/h2-6,17H,14H2,1H3,(H,15,16) |
| InChIKey | DZYKUQWOSVSNNE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|