C31H38O7 — CID 10649687
methyl (1S,4aR,5S,6S,8aR)-5-[2-(5,8-diacetyloxynaphthalen-2-yl)ethyl]-6-formyl-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 10649687) has the molecular formula C31H38O7 and a molecular weight of 522.64 g/mol. Its IUPAC name is methyl (1S,4aR,5S,6S,8aR)-5-[2-(5,8-diacetyloxynaphthalen-2-yl)ethyl]-6-formyl-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S,6S,8aR)-5-[2-(5,8-diacetyloxynaphthalen-2-yl)ethyl]-6-formyl-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10649687 |
| Molecular Formula | C31H38O7 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | methyl (1S,4aR,5S,6S,8aR)-5-[2-(5,8-diacetyloxynaphthalen-2-yl)ethyl]-6-formyl-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@@]2(C)[C@H]1CC[C@H](C=O)[C@@H]2CCc1ccc2c(OC(C)=O)ccc(OC(C)=O)c2c1 |
| InChI | InChI=1S/C31H38O7/c1-19(33)37-26-12-13-27(38-20(2)34)24-17-21(7-10-23(24)26)8-11-25-22(18-32)9-14-28-30(25,3)15-6-16-31(28,4)29(35)36-5/h7,10,12-13,17-18,22,25,28H,6,8-9,11,14-16H2,1-5H3/t22-,25+,28-,30-,31+/m1/s1 |
| InChIKey | YOXUJBLUDZPVHM-ZCKNXVKFSA-N |
| XLogP | 5.83 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|