C28H34O4 — CID 70149344
methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-5-[2-(7-methyl-5,8-dioxonaphthalen-2-yl)ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 70149344) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-5-[2-(7-methyl-5,8-dioxonaphthalen-2-yl)ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-5-[2-(7-methyl-5,8-dioxonaphthalen-2-yl)ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 70149344 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-5-[2-(7-methyl-5,8-dioxonaphthalen-2-yl)ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CC[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1CCc1ccc2c(c1)C(=O)C(C)=CC2=O |
| InChI | InChI=1S/C28H34O4/c1-17-7-12-24-27(3,13-6-14-28(24,4)26(31)32-5)22(17)11-9-19-8-10-20-21(16-19)25(30)18(2)15-23(20)29/h8,10,15-16,22,24H,1,6-7,9,11-14H2,2-5H3/t22-,24+,27+,28-/m0/s1 |
| InChIKey | WTIKAGAMODJPFU-QJGCUMMJSA-N |
| XLogP | 5.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|