C24H23BrClN5O2 — CID 10649859
4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-(1-oxidopyridin-1-ium-3-yl)piperazine-1-carboxamide (PubChem CID 10649859) has the molecular formula C24H23BrClN5O2 and a molecular weight of 528.84 g/mol. Its IUPAC name is 4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-(1-oxidopyridin-1-ium-3-yl)piperazine-1-carboxamide.
| Compound Name | 4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-(1-oxidopyridin-1-ium-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 10649859 |
| Molecular Formula | C24H23BrClN5O2 |
| Molecular Weight | 528.84 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-(1-oxidopyridin-1-ium-3-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc[n+]([O-])c1)N1CCN(C2c3ccc(Cl)cc3CCc3cc(Br)cnc32)CC1 |
| InChI | InChI=1S/C24H23BrClN5O2/c25-18-12-17-4-3-16-13-19(26)5-6-21(16)23(22(17)27-14-18)29-8-10-30(11-9-29)24(32)28-20-2-1-7-31(33)15-20/h1-2,5-7,12-15,23H,3-4,8-11H2,(H,28,32) |
| InChIKey | CJKUZCQCDLBCPJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|