C11H20O4S — CID 106499926
4-hydroxy-4-(propylsulfinylmethyl)cyclohexane-1-carboxylic acid (PubChem CID 106499926) has the molecular formula C11H20O4S and a molecular weight of 248.34 g/mol. Its IUPAC name is 4-hydroxy-4-(propylsulfinylmethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-hydroxy-4-(propylsulfinylmethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106499926 |
| Molecular Formula | C11H20O4S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-hydroxy-4-(propylsulfinylmethyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCS(=O)CC1(O)CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C11H20O4S/c1-2-7-16(15)8-11(14)5-3-9(4-6-11)10(12)13/h9,14H,2-8H2,1H3,(H,12,13) |
| InChIKey | XJSXKQLUAGQMKC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |