C12H22O4S — CID 106499925
4-(tert-butylsulfinylmethyl)-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 106499925) has the molecular formula C12H22O4S and a molecular weight of 262.37 g/mol. Its IUPAC name is 4-(tert-butylsulfinylmethyl)-4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-(tert-butylsulfinylmethyl)-4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106499925 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-(tert-butylsulfinylmethyl)-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)S(=O)CC1(O)CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C12H22O4S/c1-11(2,3)17(16)8-12(15)6-4-9(5-7-12)10(13)14/h9,15H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | HADZEWDDWRSEAQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |