C14H24O5S — CID 106498339
4-(cyclopentylmethylsulfonylmethyl)-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 106498339) has the molecular formula C14H24O5S and a molecular weight of 304.41 g/mol. Its IUPAC name is 4-(cyclopentylmethylsulfonylmethyl)-4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-(cyclopentylmethylsulfonylmethyl)-4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106498339 |
| Molecular Formula | C14H24O5S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-(cyclopentylmethylsulfonylmethyl)-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(O)(CS(=O)(=O)CC2CCCC2)CC1 |
| InChI | InChI=1S/C14H24O5S/c15-13(16)12-5-7-14(17,8-6-12)10-20(18,19)9-11-3-1-2-4-11/h11-12,17H,1-10H2,(H,15,16) |
| InChIKey | QKWTVJNBUGANAZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |