C10H17NO6S — CID 114231247
4-[(2-amino-2-oxoethyl)sulfonylmethyl]-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 114231247) has the molecular formula C10H17NO6S and a molecular weight of 279.31 g/mol. Its IUPAC name is 4-[(2-amino-2-oxoethyl)sulfonylmethyl]-4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-amino-2-oxoethyl)sulfonylmethyl]-4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 114231247 |
| Molecular Formula | C10H17NO6S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-[(2-amino-2-oxoethyl)sulfonylmethyl]-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | NC(=O)CS(=O)(=O)CC1(O)CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C10H17NO6S/c11-8(12)5-18(16,17)6-10(15)3-1-7(2-4-10)9(13)14/h7,15H,1-6H2,(H2,11,12)(H,13,14) |
| InChIKey | RCJKQOGDAGUNBY-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |