C10H18O5S — CID 106498315
4-(ethylsulfonylmethyl)-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 106498315) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-(ethylsulfonylmethyl)-4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-(ethylsulfonylmethyl)-4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106498315 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-(ethylsulfonylmethyl)-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | CCS(=O)(=O)CC1(O)CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C10H18O5S/c1-2-16(14,15)7-10(13)5-3-8(4-6-10)9(11)12/h8,13H,2-7H2,1H3,(H,11,12) |
| InChIKey | FTOSUHNYOVVFRL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |