C16H13ClO4 — CID 106500778
2-chloro-5-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid (PubChem CID 106500778) has the molecular formula C16H13ClO4 and a molecular weight of 304.73 g/mol. Its IUPAC name is 2-chloro-5-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid.
| Compound Name | 2-chloro-5-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 106500778 |
| Molecular Formula | C16H13ClO4 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-chloro-5-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid |
| SMILES | O=C(O)c1cc(OCC2COc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C16H13ClO4/c17-14-6-5-11(7-13(14)16(18)19)20-8-10-9-21-15-4-2-1-3-12(10)15/h1-7,10H,8-9H2,(H,18,19) |
| InChIKey | UEGIPPKJUCRAKK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |