C16H14ClNO3 — CID 115547763
2,3-dihydro-1-benzofuran-3-ylmethyl 2-amino-3-chlorobenzoate (PubChem CID 115547763) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-3-ylmethyl 2-amino-3-chlorobenzoate.
| Compound Name | 2,3-dihydro-1-benzofuran-3-ylmethyl 2-amino-3-chlorobenzoate |
|---|---|
| PubChem CID | 115547763 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-3-ylmethyl 2-amino-3-chlorobenzoate |
| SMILES | Nc1c(Cl)cccc1C(=O)OCC1COc2ccccc21 |
| InChI | InChI=1S/C16H14ClNO3/c17-13-6-3-5-12(15(13)18)16(19)21-9-10-8-20-14-7-2-1-4-11(10)14/h1-7,10H,8-9,18H2 |
| InChIKey | GLHDLNOBLCOMPE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|