2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid

C16H13ClO4 — CID 114320330

IUPAC2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid
SMILESO=C(O)c1c(Cl)cccc1OCC1COc2ccccc21
InChIInChI=1S/C16H13ClO4/c17-12-5-3-7-14(15(12)16(18)19)21-9-10-8-20-13-6-2-1-4-11(10)13/h1-7,10H,8-9H2,(H,18,19)
InChIKeyJSJOMEGZSJQNEB-UHFFFAOYSA-N
MW304.73 g/mol
LogP3.59
Rot. Bonds4

About 2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid

2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid (PubChem CID 114320330) has the molecular formula C16H13ClO4 and a molecular weight of 304.73 g/mol. Its IUPAC name is 2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid.

Molecular Properties

Compound Name2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid
PubChem CID114320330
Molecular FormulaC16H13ClO4
Molecular Weight304.73 g/mol
Exact Mass304.05
IUPAC Name2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid
SMILESO=C(O)c1c(Cl)cccc1OCC1COc2ccccc21
InChIInChI=1S/C16H13ClO4/c17-12-5-3-7-14(15(12)16(18)19)21-9-10-8-20-13-6-2-1-4-11(10)13/h1-7,10H,8-9H2,(H,18,19)
InChIKeyJSJOMEGZSJQNEB-UHFFFAOYSA-N
XLogP3.59
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.73
LogP ≤ 53.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid?
The IUPAC name of 2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid (CID 114320330) is 2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid.
What is the SMILES notation for 2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid?
The canonical SMILES for 2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid is O=C(O)c1c(Cl)cccc1OCC1COc2ccccc21.
What is the InChIKey of 2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid?
The InChIKey is JSJOMEGZSJQNEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClO4/c17-12-5-3-7-14(15(12)16(18)19)21-9-10-8-20-13-6-2-1-4-11(10)13/h1-7,10H,8-9H2,(H,18,19).
What are the key properties of 2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid?
2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid has a molecular weight of 304.73 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(2,3-dihydro-1-benzofuran-3-ylmethoxy)benzoic acid is sourced from PubChem (CID 114320330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).