C14H19ClN2O2S — CID 106501052
N-(3-amino-3-sulfanylidenepropyl)-2-chloro-5-hydroxy-N-(2-methylpropyl)benzamide (PubChem CID 106501052) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-2-chloro-5-hydroxy-N-(2-methylpropyl)benzamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-2-chloro-5-hydroxy-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 106501052 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-2-chloro-5-hydroxy-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CCC(N)=S)C(=O)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C14H19ClN2O2S/c1-9(2)8-17(6-5-13(16)20)14(19)11-7-10(18)3-4-12(11)15/h3-4,7,9,18H,5-6,8H2,1-2H3,(H2,16,20) |
| InChIKey | UMJMHGIGCSPMAC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|