C14H18ClFN2OS — CID 81453961
N-(3-amino-3-sulfanylidenepropyl)-2-chloro-3-fluoro-N-(2-methylpropyl)benzamide (PubChem CID 81453961) has the molecular formula C14H18ClFN2OS and a molecular weight of 316.83 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-2-chloro-3-fluoro-N-(2-methylpropyl)benzamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-2-chloro-3-fluoro-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 81453961 |
| Molecular Formula | C14H18ClFN2OS |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-2-chloro-3-fluoro-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CCC(N)=S)C(=O)c1cccc(F)c1Cl |
| InChI | InChI=1S/C14H18ClFN2OS/c1-9(2)8-18(7-6-12(17)20)14(19)10-4-3-5-11(16)13(10)15/h3-5,9H,6-8H2,1-2H3,(H2,17,20) |
| InChIKey | GYCYDCSSDFQFOF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|