C13H20BrNO2 — CID 106508332
2-(aminomethyl)-4-(4-bromophenoxy)-2-ethylbutan-1-ol (PubChem CID 106508332) has the molecular formula C13H20BrNO2 and a molecular weight of 302.21 g/mol. Its IUPAC name is 2-(aminomethyl)-4-(4-bromophenoxy)-2-ethylbutan-1-ol.
| Compound Name | 2-(aminomethyl)-4-(4-bromophenoxy)-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 106508332 |
| Molecular Formula | C13H20BrNO2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-(aminomethyl)-4-(4-bromophenoxy)-2-ethylbutan-1-ol |
| SMILES | CCC(CN)(CO)CCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H20BrNO2/c1-2-13(9-15,10-16)7-8-17-12-5-3-11(14)4-6-12/h3-6,16H,2,7-10,15H2,1H3 |
| InChIKey | WPSAQKCQOOZFLS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |