C15H24ClNO — CID 82138894
5-(4-chlorophenoxy)-2,2-diethylpentan-1-amine (PubChem CID 82138894) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is 5-(4-chlorophenoxy)-2,2-diethylpentan-1-amine.
| Compound Name | 5-(4-chlorophenoxy)-2,2-diethylpentan-1-amine |
|---|---|
| PubChem CID | 82138894 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 5-(4-chlorophenoxy)-2,2-diethylpentan-1-amine |
| SMILES | CCC(CC)(CN)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H24ClNO/c1-3-15(4-2,12-17)10-5-11-18-14-8-6-13(16)7-9-14/h6-9H,3-5,10-12,17H2,1-2H3 |
| InChIKey | FHIMBMNSOQPHIW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|