C14H22BrNO — CID 55106538
4-(4-bromophenoxy)-2,2-diethylbutan-1-amine (PubChem CID 55106538) has the molecular formula C14H22BrNO and a molecular weight of 300.24 g/mol. Its IUPAC name is 4-(4-bromophenoxy)-2,2-diethylbutan-1-amine.
| Compound Name | 4-(4-bromophenoxy)-2,2-diethylbutan-1-amine |
|---|---|
| PubChem CID | 55106538 |
| Molecular Formula | C14H22BrNO |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-(4-bromophenoxy)-2,2-diethylbutan-1-amine |
| SMILES | CCC(CC)(CN)CCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H22BrNO/c1-3-14(4-2,11-16)9-10-17-13-7-5-12(15)6-8-13/h5-8H,3-4,9-11,16H2,1-2H3 |
| InChIKey | MNUDDBDAJKTAAF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |