C17H31N3O3 — CID 106508417
tert-butyl N-[2-(hydroxymethyl)-2-[(1-propan-2-ylpyrazol-3-yl)methyl]butyl]carbamate (PubChem CID 106508417) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-2-[(1-propan-2-ylpyrazol-3-yl)methyl]butyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-2-[(1-propan-2-ylpyrazol-3-yl)methyl]butyl]carbamate |
|---|---|
| PubChem CID | 106508417 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-2-[(1-propan-2-ylpyrazol-3-yl)methyl]butyl]carbamate |
| SMILES | CCC(CO)(CNC(=O)OC(C)(C)C)Cc1ccn(C(C)C)n1 |
| InChI | InChI=1S/C17H31N3O3/c1-7-17(12-21,11-18-15(22)23-16(4,5)6)10-14-8-9-20(19-14)13(2)3/h8-9,13,21H,7,10-12H2,1-6H3,(H,18,22) |
| InChIKey | JWZAEOCKRWECMH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |