C17H25ClFNO3 — CID 106508439
tert-butyl N-[2-[(3-chloro-4-fluorophenyl)methyl]-2-(hydroxymethyl)butyl]carbamate (PubChem CID 106508439) has the molecular formula C17H25ClFNO3 and a molecular weight of 345.84 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-chloro-4-fluorophenyl)methyl]-2-(hydroxymethyl)butyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-chloro-4-fluorophenyl)methyl]-2-(hydroxymethyl)butyl]carbamate |
|---|---|
| PubChem CID | 106508439 |
| Molecular Formula | C17H25ClFNO3 |
| Molecular Weight | 345.84 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | tert-butyl N-[2-[(3-chloro-4-fluorophenyl)methyl]-2-(hydroxymethyl)butyl]carbamate |
| SMILES | CCC(CO)(CNC(=O)OC(C)(C)C)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H25ClFNO3/c1-5-17(11-21,10-20-15(22)23-16(2,3)4)9-12-6-7-14(19)13(18)8-12/h6-8,21H,5,9-11H2,1-4H3,(H,20,22) |
| InChIKey | OQCJZDUWCWKHLM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.84 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |