C18H33NO4 — CID 106508716
tert-butyl N-[2-(hydroxymethyl)-2-methyl-3-(1-oxaspiro[4.4]nonan-2-yl)propyl]carbamate (PubChem CID 106508716) has the molecular formula C18H33NO4 and a molecular weight of 327.46 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-2-methyl-3-(1-oxaspiro[4.4]nonan-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-2-methyl-3-(1-oxaspiro[4.4]nonan-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 106508716 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-2-methyl-3-(1-oxaspiro[4.4]nonan-2-yl)propyl]carbamate |
| SMILES | CC(CO)(CNC(=O)OC(C)(C)C)CC1CCC2(CCCC2)O1 |
| InChI | InChI=1S/C18H33NO4/c1-16(2,3)23-15(21)19-12-17(4,13-20)11-14-7-10-18(22-14)8-5-6-9-18/h14,20H,5-13H2,1-4H3,(H,19,21) |
| InChIKey | HMTJNURGWLUBTG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |