2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid

C10H10N2O2S2 — CID 106510077

IUPAC2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid
SMILESCCc1ccc(-c2sc(N)nc2C(=O)O)s1
InChIInChI=1S/C10H10N2O2S2/c1-2-5-3-4-6(15-5)8-7(9(13)14)12-10(11)16-8/h3-4H,2H2,1H3,(H2,11,12)(H,13,14)
InChIKeyIXZGDUUJWRLSSJ-UHFFFAOYSA-N
MW254.34 g/mol
LogP2.71
Rot. Bonds3

About 2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid

2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 106510077) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid
PubChem CID106510077
Molecular FormulaC10H10N2O2S2
Molecular Weight254.34 g/mol
Exact Mass254.02
IUPAC Name2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid
SMILESCCc1ccc(-c2sc(N)nc2C(=O)O)s1
InChIInChI=1S/C10H10N2O2S2/c1-2-5-3-4-6(15-5)8-7(9(13)14)12-10(11)16-8/h3-4H,2H2,1H3,(H2,11,12)(H,13,14)
InChIKeyIXZGDUUJWRLSSJ-UHFFFAOYSA-N
XLogP2.71
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.34
LogP ≤ 52.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid (CID 106510077) is 2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid is CCc1ccc(-c2sc(N)nc2C(=O)O)s1.
What is the InChIKey of 2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is IXZGDUUJWRLSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S2/c1-2-5-3-4-6(15-5)8-7(9(13)14)12-10(11)16-8/h3-4H,2H2,1H3,(H2,11,12)(H,13,14).
What are the key properties of 2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid?
2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 254.34 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(5-ethylthiophen-2-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 106510077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).