C14H21NO2S — CID 106510848
5-(4-methylcyclohexyl)-2-propyl-1,3-thiazole-4-carboxylic acid (PubChem CID 106510848) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 5-(4-methylcyclohexyl)-2-propyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(4-methylcyclohexyl)-2-propyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106510848 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 5-(4-methylcyclohexyl)-2-propyl-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCc1nc(C(=O)O)c(C2CCC(C)CC2)s1 |
| InChI | InChI=1S/C14H21NO2S/c1-3-4-11-15-12(14(16)17)13(18-11)10-7-5-9(2)6-8-10/h9-10H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | UCZQCMIKHFDHAP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |