C12H17NO3S — CID 106510949
5-(oxan-3-yl)-2-propan-2-yl-1,3-thiazole-4-carboxylic acid (PubChem CID 106510949) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 5-(oxan-3-yl)-2-propan-2-yl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(oxan-3-yl)-2-propan-2-yl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106510949 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 5-(oxan-3-yl)-2-propan-2-yl-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)c1nc(C(=O)O)c(C2CCCOC2)s1 |
| InChI | InChI=1S/C12H17NO3S/c1-7(2)11-13-9(12(14)15)10(17-11)8-4-3-5-16-6-8/h7-8H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | LSQLYADARHISRZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |