C13H17N5O2 — CID 106511814
N'-benzyl-N'-(3-methyl-5-nitroimidazol-4-yl)ethane-1,2-diamine (PubChem CID 106511814) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is N'-benzyl-N'-(3-methyl-5-nitroimidazol-4-yl)ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-(3-methyl-5-nitroimidazol-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 106511814 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N'-benzyl-N'-(3-methyl-5-nitroimidazol-4-yl)ethane-1,2-diamine |
| SMILES | Cn1cnc([N+](=O)[O-])c1N(CCN)Cc1ccccc1 |
| InChI | InChI=1S/C13H17N5O2/c1-16-10-15-12(18(19)20)13(16)17(8-7-14)9-11-5-3-2-4-6-11/h2-6,10H,7-9,14H2,1H3 |
| InChIKey | ICKYJRVCMFDSGI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|