About N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine
N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 106511823) has the molecular formula C15H18N4O2
and a molecular weight of 286.34 g/mol. Its IUPAC name is N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine |
| PubChem CID | 106511823 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | Cc1cnc(N(CCN)Cc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18N4O2/c1-12-9-14(19(20)21)15(17-10-12)18(8-7-16)11-13-5-3-2-4-6-13/h2-6,9-10H,7-8,11,16H2,1H3 |
| InChIKey | HWWGXYGSQSKSJQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine?
The IUPAC name of N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine (CID 106511823) is N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine.
What is the SMILES notation for N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine?
The canonical SMILES for N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine is Cc1cnc(N(CCN)Cc2ccccc2)c([N+](=O)[O-])c1.
What is the InChIKey of N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine?
The InChIKey is HWWGXYGSQSKSJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2/c1-12-9-14(19(20)21)15(17-10-12)18(8-7-16)11-13-5-3-2-4-6-13/h2-6,9-10H,7-8,11,16H2,1H3.
What are the key properties of N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine?
N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine has a molecular weight of 286.34 g/mol, XLogP of 2.26, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine is sourced from PubChem (CID 106511823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).