C10H16N4O2 — CID 114900555
N'-ethyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 114900555) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is N'-ethyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114900555 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N'-ethyl-N'-(5-methyl-3-nitro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | CCN(CCN)c1ncc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H16N4O2/c1-3-13(5-4-11)10-9(14(15)16)6-8(2)7-12-10/h6-7H,3-5,11H2,1-2H3 |
| InChIKey | GSCLLVJZIIOBJC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|