C33H27N5O8 — CID 10651533
3-[(4R,5R)-4-(4-nitrobenzoyl)-5-(4-nitrophenyl)-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-8-yl]-1-(4-nitrophenyl)propan-1-one (PubChem CID 10651533) has the molecular formula C33H27N5O8 and a molecular weight of 621.61 g/mol. Its IUPAC name is 3-[(4R,5R)-4-(4-nitrobenzoyl)-5-(4-nitrophenyl)-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-8-yl]-1-(4-nitrophenyl)propan-1-one.
| Compound Name | 3-[(4R,5R)-4-(4-nitrobenzoyl)-5-(4-nitrophenyl)-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-8-yl]-1-(4-nitrophenyl)propan-1-one |
|---|---|
| PubChem CID | 10651533 |
| Molecular Formula | C33H27N5O8 |
| Molecular Weight | 621.61 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | 3-[(4R,5R)-4-(4-nitrobenzoyl)-5-(4-nitrophenyl)-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-8-yl]-1-(4-nitrophenyl)propan-1-one |
| SMILES | O=C(CCN1CC[C@]2(c3ccc([N+](=O)[O-])cc3)[C@H](C(=O)c3ccc([N+](=O)[O-])cc3)CN2c2ccccc21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H27N5O8/c39-31(22-5-11-25(12-6-22)36(41)42)17-19-34-20-18-33(24-9-15-27(16-10-24)38(45)46)28(21-35(33)30-4-2-1-3-29(30)34)32(40)23-7-13-26(14-8-23)37(43)44/h1-16,28H,17-21H2/t28-,33-/m0/s1 |
| InChIKey | LJMMHGPVHNVBAV-UVMMSNCQSA-N |
| XLogP | 6.11 |
| TPSA | 170.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|