C11H5F5N2S — CID 106517225
4-(2,5-difluorophenyl)-6-(trifluoromethyl)-1H-pyrimidine-2-thione (PubChem CID 106517225) has the molecular formula C11H5F5N2S and a molecular weight of 292.23 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-6-(trifluoromethyl)-1H-pyrimidine-2-thione.
| Compound Name | 4-(2,5-difluorophenyl)-6-(trifluoromethyl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 106517225 |
| Molecular Formula | C11H5F5N2S |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 4-(2,5-difluorophenyl)-6-(trifluoromethyl)-1H-pyrimidine-2-thione |
| SMILES | Fc1ccc(F)c(-c2cc(C(F)(F)F)[nH]c(=S)n2)c1 |
| InChI | InChI=1S/C11H5F5N2S/c12-5-1-2-7(13)6(3-5)8-4-9(11(14,15)16)18-10(19)17-8/h1-4H,(H,17,18,19) |
| InChIKey | SAQRIXIVIQSAGH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|