C9H4ClF3N2S2 — CID 107362495
4-(3-chlorothiophen-2-yl)-6-(trifluoromethyl)-1H-pyrimidine-2-thione (PubChem CID 107362495) has the molecular formula C9H4ClF3N2S2 and a molecular weight of 296.73 g/mol. Its IUPAC name is 4-(3-chlorothiophen-2-yl)-6-(trifluoromethyl)-1H-pyrimidine-2-thione.
| Compound Name | 4-(3-chlorothiophen-2-yl)-6-(trifluoromethyl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 107362495 |
| Molecular Formula | C9H4ClF3N2S2 |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | 4-(3-chlorothiophen-2-yl)-6-(trifluoromethyl)-1H-pyrimidine-2-thione |
| SMILES | FC(F)(F)c1cc(-c2sccc2Cl)nc(=S)[nH]1 |
| InChI | InChI=1S/C9H4ClF3N2S2/c10-4-1-2-17-7(4)5-3-6(9(11,12)13)15-8(16)14-5/h1-3H,(H,14,15,16) |
| InChIKey | ASBZIRSLMVQPSV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|