C38H44F2NO6P — CID 10652141
(2R,3R,4R,5R)-1-benzyl-2-[diethoxyphosphoryl(difluoro)methyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine (PubChem CID 10652141) has the molecular formula C38H44F2NO6P and a molecular weight of 679.74 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1-benzyl-2-[diethoxyphosphoryl(difluoro)methyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine.
| Compound Name | (2R,3R,4R,5R)-1-benzyl-2-[diethoxyphosphoryl(difluoro)methyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 10652141 |
| Molecular Formula | C38H44F2NO6P |
| Molecular Weight | 679.74 g/mol |
| Exact Mass | 679.29 |
| IUPAC Name | (2R,3R,4R,5R)-1-benzyl-2-[diethoxyphosphoryl(difluoro)methyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C38H44F2NO6P/c1-3-46-48(42,47-4-2)38(39,40)37-36(45-28-33-23-15-8-16-24-33)35(44-27-32-21-13-7-14-22-32)34(29-43-26-31-19-11-6-12-20-31)41(37)25-30-17-9-5-10-18-30/h5-24,34-37H,3-4,25-29H2,1-2H3/t34-,35-,36+,37-/m1/s1 |
| InChIKey | VUDBENMANOLNEZ-GOFGAPPUSA-N |
| XLogP | 8.49 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.74 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|