C36H39NO3 — CID 11082041
(2R,3R,4R,5R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5-prop-2-enylpyrrolidine (PubChem CID 11082041) has the molecular formula C36H39NO3 and a molecular weight of 533.71 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5-prop-2-enylpyrrolidine.
| Compound Name | (2R,3R,4R,5R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5-prop-2-enylpyrrolidine |
|---|---|
| PubChem CID | 11082041 |
| Molecular Formula | C36H39NO3 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | (2R,3R,4R,5R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5-prop-2-enylpyrrolidine |
| SMILES | C=CC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C36H39NO3/c1-2-15-33-35(39-26-31-20-11-5-12-21-31)36(40-27-32-22-13-6-14-23-32)34(28-38-25-30-18-9-4-10-19-30)37(33)24-29-16-7-3-8-17-29/h2-14,16-23,33-36H,1,15,24-28H2/t33-,34-,35-,36-/m1/s1 |
| InChIKey | GYMTZOQMGQFQEO-MGXDLYCJSA-N |
| XLogP | 7.20 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|