C15H15NS — CID 106521765
6-(4-cyclobutylphenyl)-1H-pyridine-2-thione (PubChem CID 106521765) has the molecular formula C15H15NS and a molecular weight of 241.36 g/mol. Its IUPAC name is 6-(4-cyclobutylphenyl)-1H-pyridine-2-thione.
| Compound Name | 6-(4-cyclobutylphenyl)-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 106521765 |
| Molecular Formula | C15H15NS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 6-(4-cyclobutylphenyl)-1H-pyridine-2-thione |
| SMILES | S=c1cccc(-c2ccc(C3CCC3)cc2)[nH]1 |
| InChI | InChI=1S/C15H15NS/c17-15-6-2-5-14(16-15)13-9-7-12(8-10-13)11-3-1-4-11/h2,5-11H,1,3-4H2,(H,16,17) |
| InChIKey | ZUOVNOLRGPMFFO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|