C16H18N2O2 — CID 95473920
6-(4-cyclohexylphenyl)-1H-pyrimidine-2,4-dione (PubChem CID 95473920) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 6-(4-cyclohexylphenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(4-cyclohexylphenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 95473920 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 6-(4-cyclohexylphenyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(-c2ccc(C3CCCCC3)cc2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C16H18N2O2/c19-15-10-14(17-16(20)18-15)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h6-11H,1-5H2,(H2,17,18,19,20) |
| InChIKey | HBICGQPUYVWJBR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |