C15H19N — CID 116506684
4-(4-cyclobutylphenyl)-1,2,3,6-tetrahydropyridine (PubChem CID 116506684) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-(4-cyclobutylphenyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(4-cyclobutylphenyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 116506684 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 4-(4-cyclobutylphenyl)-1,2,3,6-tetrahydropyridine |
| SMILES | C1=C(c2ccc(C3CCC3)cc2)CCNC1 |
| InChI | InChI=1S/C15H19N/c1-2-12(3-1)13-4-6-14(7-5-13)15-8-10-16-11-9-15/h4-8,12,16H,1-3,9-11H2 |
| InChIKey | HIQKYAXJGZMUMS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |