C12H8FN3O3 — CID 106521871
6-(7-fluoro-1-benzofuran-2-yl)-4-methoxy-1H-1,3,5-triazin-2-one (PubChem CID 106521871) has the molecular formula C12H8FN3O3 and a molecular weight of 261.21 g/mol. Its IUPAC name is 6-(7-fluoro-1-benzofuran-2-yl)-4-methoxy-1H-1,3,5-triazin-2-one.
| Compound Name | 6-(7-fluoro-1-benzofuran-2-yl)-4-methoxy-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 106521871 |
| Molecular Formula | C12H8FN3O3 |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 6-(7-fluoro-1-benzofuran-2-yl)-4-methoxy-1H-1,3,5-triazin-2-one |
| SMILES | COc1nc(-c2cc3cccc(F)c3o2)[nH]c(=O)n1 |
| InChI | InChI=1S/C12H8FN3O3/c1-18-12-15-10(14-11(17)16-12)8-5-6-3-2-4-7(13)9(6)19-8/h2-5H,1H3,(H,14,15,16,17) |
| InChIKey | PTELDANCMQMEJW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |