C43H35N3O6S — CID 10652466
N-[[(2S,4R)-1-(2-benzoylbenzoyl)-4-[(2-phenylphenyl)methoxy]pyrrolidin-2-yl]methyl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide (PubChem CID 10652466) has the molecular formula C43H35N3O6S and a molecular weight of 721.84 g/mol. Its IUPAC name is N-[[(2S,4R)-1-(2-benzoylbenzoyl)-4-[(2-phenylphenyl)methoxy]pyrrolidin-2-yl]methyl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide.
| Compound Name | N-[[(2S,4R)-1-(2-benzoylbenzoyl)-4-[(2-phenylphenyl)methoxy]pyrrolidin-2-yl]methyl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 10652466 |
| Molecular Formula | C43H35N3O6S |
| Molecular Weight | 721.84 g/mol |
| Exact Mass | 721.22 |
| IUPAC Name | N-[[(2S,4R)-1-(2-benzoylbenzoyl)-4-[(2-phenylphenyl)methoxy]pyrrolidin-2-yl]methyl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(C(=O)NC[C@@H]3C[C@@H](OCc4ccccc4-c4ccccc4)CN3C(=O)c3ccccc3C(=O)c3ccccc3)cc2)S1 |
| InChI | InChI=1S/C43H35N3O6S/c47-39(30-13-5-2-6-14-30)36-17-9-10-18-37(36)42(50)46-26-34(52-27-32-15-7-8-16-35(32)29-11-3-1-4-12-29)24-33(46)25-44-40(48)31-21-19-28(20-22-31)23-38-41(49)45-43(51)53-38/h1-23,33-34H,24-27H2,(H,44,48)(H,45,49,51)/b38-23-/t33-,34+/m0/s1 |
| InChIKey | SWCLXBYKQXAJGN-JIZJIGLTSA-N |
| XLogP | 7.14 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.84 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|