C14H16FN3OS — CID 106529651
[3-fluoro-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]methanol (PubChem CID 106529651) has the molecular formula C14H16FN3OS and a molecular weight of 293.37 g/mol. Its IUPAC name is [3-fluoro-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]methanol.
| Compound Name | [3-fluoro-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 106529651 |
| Molecular Formula | C14H16FN3OS |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | [3-fluoro-5-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]methanol |
| SMILES | OCc1cc(F)cc(N2CCN(c3nccs3)CC2)c1 |
| InChI | InChI=1S/C14H16FN3OS/c15-12-7-11(10-19)8-13(9-12)17-2-4-18(5-3-17)14-16-1-6-20-14/h1,6-9,19H,2-5,10H2 |
| InChIKey | CBGBLRBJIWPRNI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |