C14H17F2N3 — CID 106531898
3-tert-butyl-5-(3,5-difluorophenyl)-2-methylimidazol-4-amine (PubChem CID 106531898) has the molecular formula C14H17F2N3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-tert-butyl-5-(3,5-difluorophenyl)-2-methylimidazol-4-amine.
| Compound Name | 3-tert-butyl-5-(3,5-difluorophenyl)-2-methylimidazol-4-amine |
|---|---|
| PubChem CID | 106531898 |
| Molecular Formula | C14H17F2N3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-tert-butyl-5-(3,5-difluorophenyl)-2-methylimidazol-4-amine |
| SMILES | Cc1nc(-c2cc(F)cc(F)c2)c(N)n1C(C)(C)C |
| InChI | InChI=1S/C14H17F2N3/c1-8-18-12(13(17)19(8)14(2,3)4)9-5-10(15)7-11(16)6-9/h5-7H,17H2,1-4H3 |
| InChIKey | ICENXWPKPVRRHO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |