C13H16F2N4 — CID 106531957
2-tert-butyl-4-(3,5-difluorophenyl)imidazole-1,5-diamine (PubChem CID 106531957) has the molecular formula C13H16F2N4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-tert-butyl-4-(3,5-difluorophenyl)imidazole-1,5-diamine.
| Compound Name | 2-tert-butyl-4-(3,5-difluorophenyl)imidazole-1,5-diamine |
|---|---|
| PubChem CID | 106531957 |
| Molecular Formula | C13H16F2N4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-tert-butyl-4-(3,5-difluorophenyl)imidazole-1,5-diamine |
| SMILES | CC(C)(C)c1nc(-c2cc(F)cc(F)c2)c(N)n1N |
| InChI | InChI=1S/C13H16F2N4/c1-13(2,3)12-18-10(11(16)19(12)17)7-4-8(14)6-9(15)5-7/h4-6H,16-17H2,1-3H3 |
| InChIKey | VRIDZGHJQYIFLB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |