C12H14F2N2 — CID 174310825
1-tert-butyl-5,7-difluoro-2-methylbenzimidazole (PubChem CID 174310825) has the molecular formula C12H14F2N2 and a molecular weight of 224.25 g/mol. Its IUPAC name is 1-tert-butyl-5,7-difluoro-2-methylbenzimidazole.
| Compound Name | 1-tert-butyl-5,7-difluoro-2-methylbenzimidazole |
|---|---|
| PubChem CID | 174310825 |
| Molecular Formula | C12H14F2N2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-tert-butyl-5,7-difluoro-2-methylbenzimidazole |
| SMILES | Cc1nc2cc(F)cc(F)c2n1C(C)(C)C |
| InChI | InChI=1S/C12H14F2N2/c1-7-15-10-6-8(13)5-9(14)11(10)16(7)12(2,3)4/h5-6H,1-4H3 |
| InChIKey | ZKVGBOYPRXZGNL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |