C17H21FN2 — CID 106532649
N-[3-(2-aminoethyl)-5-fluorophenyl]-N,2,4-trimethylaniline (PubChem CID 106532649) has the molecular formula C17H21FN2 and a molecular weight of 272.37 g/mol. Its IUPAC name is N-[3-(2-aminoethyl)-5-fluorophenyl]-N,2,4-trimethylaniline.
| Compound Name | N-[3-(2-aminoethyl)-5-fluorophenyl]-N,2,4-trimethylaniline |
|---|---|
| PubChem CID | 106532649 |
| Molecular Formula | C17H21FN2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N-[3-(2-aminoethyl)-5-fluorophenyl]-N,2,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)c2cc(F)cc(CCN)c2)c(C)c1 |
| InChI | InChI=1S/C17H21FN2/c1-12-4-5-17(13(2)8-12)20(3)16-10-14(6-7-19)9-15(18)11-16/h4-5,8-11H,6-7,19H2,1-3H3 |
| InChIKey | GRWFEKVEQKYHIK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|