C14H19FN4S — CID 106534160
N-[[3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-fluorophenyl]methyl]propan-1-amine (PubChem CID 106534160) has the molecular formula C14H19FN4S and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[[3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-fluorophenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-fluorophenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106534160 |
| Molecular Formula | C14H19FN4S |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N-[[3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-fluorophenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(F)cc(Sc2nnc(C)n2C)c1 |
| InChI | InChI=1S/C14H19FN4S/c1-4-5-16-9-11-6-12(15)8-13(7-11)20-14-18-17-10(2)19(14)3/h6-8,16H,4-5,9H2,1-3H3 |
| InChIKey | WRRUTPXLRYIKEG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|