4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid

C14H8FNO3S — CID 106535041

IUPAC4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid
SMILESO=C(O)c1ccc(F)c(Sc2nccc3occc23)c1
InChIInChI=1S/C14H8FNO3S/c15-10-2-1-8(14(17)18)7-12(10)20-13-9-4-6-19-11(9)3-5-16-13/h1-7H,(H,17,18)
InChIKeyFGKDLTYVXQQAJK-UHFFFAOYSA-N
MW289.29 g/mol
LogP3.82
Rot. Bonds3

About 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid

4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid (PubChem CID 106535041) has the molecular formula C14H8FNO3S and a molecular weight of 289.29 g/mol. Its IUPAC name is 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid.

Molecular Properties

Compound Name4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid
PubChem CID106535041
Molecular FormulaC14H8FNO3S
Molecular Weight289.29 g/mol
Exact Mass289.02
IUPAC Name4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid
SMILESO=C(O)c1ccc(F)c(Sc2nccc3occc23)c1
InChIInChI=1S/C14H8FNO3S/c15-10-2-1-8(14(17)18)7-12(10)20-13-9-4-6-19-11(9)3-5-16-13/h1-7H,(H,17,18)
InChIKeyFGKDLTYVXQQAJK-UHFFFAOYSA-N
XLogP3.82
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.29
LogP ≤ 53.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid?
The IUPAC name of 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid (CID 106535041) is 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid.
What is the SMILES notation for 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid?
The canonical SMILES for 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid is O=C(O)c1ccc(F)c(Sc2nccc3occc23)c1.
What is the InChIKey of 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid?
The InChIKey is FGKDLTYVXQQAJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8FNO3S/c15-10-2-1-8(14(17)18)7-12(10)20-13-9-4-6-19-11(9)3-5-16-13/h1-7H,(H,17,18).
What are the key properties of 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid?
4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid has a molecular weight of 289.29 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid is sourced from PubChem (CID 106535041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).