C14H8FNO3S — CID 106535041
4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid (PubChem CID 106535041) has the molecular formula C14H8FNO3S and a molecular weight of 289.29 g/mol. Its IUPAC name is 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid.
| Compound Name | 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 106535041 |
| Molecular Formula | C14H8FNO3S |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 4-fluoro-3-furo[3,2-c]pyridin-4-ylsulfanylbenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(Sc2nccc3occc23)c1 |
| InChI | InChI=1S/C14H8FNO3S/c15-10-2-1-8(14(17)18)7-12(10)20-13-9-4-6-19-11(9)3-5-16-13/h1-7H,(H,17,18) |
| InChIKey | FGKDLTYVXQQAJK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |