C9H12N2 — CID 10654367
6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine (PubChem CID 10654367) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine.
| Compound Name | 6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine |
|---|---|
| PubChem CID | 10654367 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine |
| SMILES | c1ncc2c(n1)CCCCC2 |
| InChI | InChI=1S/C9H12N2/c1-2-4-8-6-10-7-11-9(8)5-3-1/h6-7H,1-5H2 |
| InChIKey | WYANEPDSNWAVNE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |